C12H13N3O4S — CID 159334500
[5-amino-4-hydroxy-3-(methyldiazenyl)naphthalen-2-yl]methanesulfonic acid (PubChem CID 159334500) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is [5-amino-4-hydroxy-3-(methyldiazenyl)naphthalen-2-yl]methanesulfonic acid.
| Compound Name | [5-amino-4-hydroxy-3-(methyldiazenyl)naphthalen-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 159334500 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | [5-amino-4-hydroxy-3-(methyldiazenyl)naphthalen-2-yl]methanesulfonic acid |
| SMILES | C/N=N/c1c(CS(=O)(=O)O)cc2cccc(N)c2c1O |
| InChI | InChI=1S/C12H13N3O4S/c1-14-15-11-8(6-20(17,18)19)5-7-3-2-4-9(13)10(7)12(11)16/h2-5,16H,6,13H2,1H3,(H,17,18,19)/b15-14+ |
| InChIKey | UYTADNYSFNGSKL-CCEZHUSRSA-N |
| XLogP | 2.23 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|