C16H12ClN3O5S — CID 3023880
3-[(8-amino-2-hydroxynaphthalen-1-yl)diazenyl]-5-chloro-2-hydroxybenzenesulfonic acid (PubChem CID 3023880) has the molecular formula C16H12ClN3O5S and a molecular weight of 393.81 g/mol. Its IUPAC name is 3-[(8-amino-2-hydroxynaphthalen-1-yl)diazenyl]-5-chloro-2-hydroxybenzenesulfonic acid.
| Compound Name | 3-[(8-amino-2-hydroxynaphthalen-1-yl)diazenyl]-5-chloro-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 3023880 |
| Molecular Formula | C16H12ClN3O5S |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 3-[(8-amino-2-hydroxynaphthalen-1-yl)diazenyl]-5-chloro-2-hydroxybenzenesulfonic acid |
| SMILES | Nc1cccc2ccc(O)c(/N=N/c3cc(Cl)cc(S(=O)(=O)O)c3O)c12 |
| InChI | InChI=1S/C16H12ClN3O5S/c17-9-6-11(16(22)13(7-9)26(23,24)25)19-20-15-12(21)5-4-8-2-1-3-10(18)14(8)15/h1-7,21-22H,18H2,(H,23,24,25)/b20-19+ |
| InChIKey | GDLZPSDMNDJHSR-FMQUCBEESA-N |
| XLogP | 4.15 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|