C13H18N2O7S2 — CID 136645025
8-(deuteriomethyl)-2-(methyldiazenyl)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol;methanesulfonic acid (PubChem CID 136645025) has the molecular formula C13H18N2O7S2 and a molecular weight of 379.43 g/mol. Its IUPAC name is 8-(deuteriomethyl)-2-(methyldiazenyl)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol;methanesulfonic acid.
| Compound Name | 8-(deuteriomethyl)-2-(methyldiazenyl)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 136645025 |
| Molecular Formula | C13H18N2O7S2 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 8-(deuteriomethyl)-2-(methyldiazenyl)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.[2H]Cc1cccc2cc(S(O)(O)O)c(/N=N/C)c(O)c12 |
| InChI | InChI=1S/C12H14N2O4S.CH4O3S/c1-7-4-3-5-8-6-9(19(16,17)18)11(14-13-2)12(15)10(7)8;1-5(2,3)4/h3-6,15-18H,1-2H3;1H3,(H,2,3,4)/b14-13+;/i1D; |
| InChIKey | QGBHUWZIRUZGFQ-IVYAWIQHSA-N |
| XLogP | 3.65 |
| TPSA | 160.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|