C22H23N5O5S — CID 158289425
5-acetamido-3-[[2,5-dimethyl-4-(methyldiazenyl)phenyl]diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid (PubChem CID 158289425) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is 5-acetamido-3-[[2,5-dimethyl-4-(methyldiazenyl)phenyl]diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid.
| Compound Name | 5-acetamido-3-[[2,5-dimethyl-4-(methyldiazenyl)phenyl]diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 158289425 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 5-acetamido-3-[[2,5-dimethyl-4-(methyldiazenyl)phenyl]diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid |
| SMILES | C/N=N/c1cc(C)c(/N=N/c2c(S(=O)(=O)O)cc3cc(C)cc(NC(C)=O)c3c2O)cc1C |
| InChI | InChI=1S/C22H23N5O5S/c1-11-6-15-10-19(33(30,31)32)21(22(29)20(15)18(7-11)24-14(4)28)27-26-17-9-12(2)16(25-23-5)8-13(17)3/h6-10,29H,1-5H3,(H,24,28)(H,30,31,32)/b25-23+,27-26+ |
| InChIKey | DHNMHACUEFVZND-OPIJNEHBSA-N |
| XLogP | 5.80 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|