C23H16Br2N4O11S3 — CID 136740113
3-[(2,6-dibromo-4-methylphenyl)diazenyl]-4,5-dihydroxy-6-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136740113) has the molecular formula C23H16Br2N4O11S3 and a molecular weight of 780.41 g/mol. Its IUPAC name is 3-[(2,6-dibromo-4-methylphenyl)diazenyl]-4,5-dihydroxy-6-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 3-[(2,6-dibromo-4-methylphenyl)diazenyl]-4,5-dihydroxy-6-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136740113 |
| Molecular Formula | C23H16Br2N4O11S3 |
| Molecular Weight | 780.41 g/mol |
| Exact Mass | 777.83 |
| IUPAC Name | 3-[(2,6-dibromo-4-methylphenyl)diazenyl]-4,5-dihydroxy-6-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Cc1cc(Br)c(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccccc4S(=O)(=O)O)c(O)c3c2O)c(Br)c1 |
| InChI | InChI=1S/C23H16Br2N4O11S3/c1-10-6-12(24)19(13(25)7-10)27-29-21-17(43(38,39)40)9-11-8-16(42(35,36)37)20(22(30)18(11)23(21)31)28-26-14-4-2-3-5-15(14)41(32,33)34/h2-9,30-31H,1H3,(H,32,33,34)(H,35,36,37)(H,38,39,40)/b28-26+,29-27+ |
| InChIKey | ZJGDWDYVSQNJKC-TUUFZWAFSA-N |
| XLogP | 6.66 |
| TPSA | 253.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.41 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|