C23H17AsBr2N4O11S2 — CID 136728692
3-[(2-arsonophenyl)diazenyl]-6-[(2,6-dibromo-4-methylphenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136728692) has the molecular formula C23H17AsBr2N4O11S2 and a molecular weight of 824.27 g/mol. Its IUPAC name is 3-[(2-arsonophenyl)diazenyl]-6-[(2,6-dibromo-4-methylphenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[(2-arsonophenyl)diazenyl]-6-[(2,6-dibromo-4-methylphenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136728692 |
| Molecular Formula | C23H17AsBr2N4O11S2 |
| Molecular Weight | 824.27 g/mol |
| Exact Mass | 821.79 |
| IUPAC Name | 3-[(2-arsonophenyl)diazenyl]-6-[(2,6-dibromo-4-methylphenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Cc1cc(Br)c(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccccc4[As](=O)(O)O)c(O)c3c2O)c(Br)c1 |
| InChI | InChI=1S/C23H17AsBr2N4O11S2/c1-10-6-13(25)19(14(26)7-10)28-30-21-17(43(39,40)41)9-11-8-16(42(36,37)38)20(22(31)18(11)23(21)32)29-27-15-5-3-2-4-12(15)24(33,34)35/h2-9,31-32H,1H3,(H2,33,34,35)(H,36,37,38)(H,39,40,41)/b29-27+,30-28+ |
| InChIKey | PXANOQVRODFVGZ-QAVVBOBSSA-N |
| XLogP | 4.97 |
| TPSA | 256.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.27 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|