C23H15AsBr2N4O13S2 — CID 136726074
2-[[7-[(3-arsonophenyl)diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]-3,5-dibromobenzoic acid (PubChem CID 136726074) has the molecular formula C23H15AsBr2N4O13S2 and a molecular weight of 854.25 g/mol. Its IUPAC name is 2-[[7-[(3-arsonophenyl)diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]-3,5-dibromobenzoic acid.
| Compound Name | 2-[[7-[(3-arsonophenyl)diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]-3,5-dibromobenzoic acid |
|---|---|
| PubChem CID | 136726074 |
| Molecular Formula | C23H15AsBr2N4O13S2 |
| Molecular Weight | 854.25 g/mol |
| Exact Mass | 851.77 |
| IUPAC Name | 2-[[7-[(3-arsonophenyl)diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]-3,5-dibromobenzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(Br)c1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3cccc([As](=O)(O)O)c3)c(O)c2c1O |
| InChI | InChI=1S/C23H15AsBr2N4O13S2/c25-11-7-13(23(33)34)18(14(26)8-11)28-30-20-16(45(41,42)43)5-9-4-15(44(38,39)40)19(21(31)17(9)22(20)32)29-27-12-3-1-2-10(6-12)24(35,36)37/h1-8,31-32H,(H,33,34)(H2,35,36,37)(H,38,39,40)(H,41,42,43)/b29-27+,30-28+ |
| InChIKey | FAGXHJNTNZBEPR-QAVVBOBSSA-N |
| XLogP | 4.36 |
| TPSA | 293.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|