C22H14AsBr3O11S2 — CID 101397671
3-(2-arsonophenyl)-4,5-dihydroxy-6-(2,4,6-tribromophenyl)naphthalene-2,7-disulfonic acid (PubChem CID 101397671) has the molecular formula C22H14AsBr3O11S2 and a molecular weight of 833.11 g/mol. Its IUPAC name is 3-(2-arsonophenyl)-4,5-dihydroxy-6-(2,4,6-tribromophenyl)naphthalene-2,7-disulfonic acid.
| Compound Name | 3-(2-arsonophenyl)-4,5-dihydroxy-6-(2,4,6-tribromophenyl)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 101397671 |
| Molecular Formula | C22H14AsBr3O11S2 |
| Molecular Weight | 833.11 g/mol |
| Exact Mass | 829.67 |
| IUPAC Name | 3-(2-arsonophenyl)-4,5-dihydroxy-6-(2,4,6-tribromophenyl)naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc2cc(S(=O)(=O)O)c(-c3c(Br)cc(Br)cc3Br)c(O)c2c(O)c1-c1ccccc1[As](=O)(O)O |
| InChI | InChI=1S/C22H14AsBr3O11S2/c24-10-7-13(25)19(14(26)8-10)20-16(39(35,36)37)6-9-5-15(38(32,33)34)18(21(27)17(9)22(20)28)11-3-1-2-4-12(11)23(29,30)31/h1-8,27-28H,(H2,29,30,31)(H,32,33,34)(H,35,36,37) |
| InChIKey | JPRBKRQNAVXUAT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.11 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|