C22H14Cl2N4O14P2S2+2 — CID 136638216
[5-chloro-2-[[7-[[4-chloro-2-[hydroxy(oxo)phosphaniumyl]oxyphenyl]diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]phenoxy]-hydroxy-oxophosphanium (PubChem CID 136638216) has the molecular formula C22H14Cl2N4O14P2S2+2 and a molecular weight of 755.36 g/mol. Its IUPAC name is [5-chloro-2-[[7-[[4-chloro-2-[hydroxy(oxo)phosphaniumyl]oxyphenyl]diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]phenoxy]-hydroxy-oxophosphanium.
| Compound Name | [5-chloro-2-[[7-[[4-chloro-2-[hydroxy(oxo)phosphaniumyl]oxyphenyl]diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]phenoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 136638216 |
| Molecular Formula | C22H14Cl2N4O14P2S2+2 |
| Molecular Weight | 755.36 g/mol |
| Exact Mass | 753.88 |
| IUPAC Name | [5-chloro-2-[[7-[[4-chloro-2-[hydroxy(oxo)phosphaniumyl]oxyphenyl]diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]phenoxy]-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)Oc1cc(Cl)ccc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(Cl)cc3O[P+](=O)O)c(O)c2c1O |
| InChI | InChI=1S/C22H12Cl2N4O14P2S2/c23-10-1-3-12(14(7-10)41-43(31)32)25-27-19-16(45(35,36)37)5-9-6-17(46(38,39)40)20(22(30)18(9)21(19)29)28-26-13-4-2-11(24)8-15(13)42-44(33)34/h1-8H,(H4-2,25,26,29,30,31,32,33,34,35,36,37,38,39,40)/p+2 |
| InChIKey | QSJMLMJZNUKXJW-UHFFFAOYSA-P |
| XLogP | 6.94 |
| TPSA | 291.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.36 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|