C34H23Cl2N7O8S3 — CID 135424412
4-amino-3-[(2,5-dichlorophenyl)diazenyl]-5-hydroxy-6-[[4-[4-[(4-hydroxyphenyl)diazenyl]phenyl]sulfanylphenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 135424412) has the molecular formula C34H23Cl2N7O8S3 and a molecular weight of 824.71 g/mol. Its IUPAC name is 4-amino-3-[(2,5-dichlorophenyl)diazenyl]-5-hydroxy-6-[[4-[4-[(4-hydroxyphenyl)diazenyl]phenyl]sulfanylphenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[(2,5-dichlorophenyl)diazenyl]-5-hydroxy-6-[[4-[4-[(4-hydroxyphenyl)diazenyl]phenyl]sulfanylphenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135424412 |
| Molecular Formula | C34H23Cl2N7O8S3 |
| Molecular Weight | 824.71 g/mol |
| Exact Mass | 823.01 |
| IUPAC Name | 4-amino-3-[(2,5-dichlorophenyl)diazenyl]-5-hydroxy-6-[[4-[4-[(4-hydroxyphenyl)diazenyl]phenyl]sulfanylphenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2cc(Cl)ccc2Cl)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(Sc4ccc(/N=N/c5ccc(O)cc5)cc4)cc3)c(O)c12 |
| InChI | InChI=1S/C34H23Cl2N7O8S3/c35-19-1-14-26(36)27(17-19)41-42-32-28(53(46,47)48)15-18-16-29(54(49,50)51)33(34(45)30(18)31(32)37)43-40-22-6-12-25(13-7-22)52-24-10-4-21(5-11-24)39-38-20-2-8-23(44)9-3-20/h1-17,44-45H,37H2,(H,46,47,48)(H,49,50,51)/b39-38+,42-41+,43-40+ |
| InChIKey | XSHXIBNMPNPIGZ-FXOKBKBZSA-N |
| XLogP | 11.03 |
| TPSA | 249.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.71 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|