C22H16ClN4O11PS2 — CID 136771585
3-[(4-chloro-2-phosphonophenyl)diazenyl]-4,5-dihydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid (PubChem CID 136771585) has the molecular formula C22H16ClN4O11PS2 and a molecular weight of 642.95 g/mol. Its IUPAC name is 3-[(4-chloro-2-phosphonophenyl)diazenyl]-4,5-dihydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[(4-chloro-2-phosphonophenyl)diazenyl]-4,5-dihydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136771585 |
| Molecular Formula | C22H16ClN4O11PS2 |
| Molecular Weight | 642.95 g/mol |
| Exact Mass | 641.97 |
| IUPAC Name | 3-[(4-chloro-2-phosphonophenyl)diazenyl]-4,5-dihydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| SMILES | O=P(O)(O)c1cc(Cl)ccc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c(O)c2c1O |
| InChI | InChI=1S/C22H16ClN4O11PS2/c23-12-6-7-14(15(10-12)39(30,31)32)25-27-20-17(41(36,37)38)9-11-8-16(40(33,34)35)19(21(28)18(11)22(20)29)26-24-13-4-2-1-3-5-13/h1-10,28-29H,(H2,30,31,32)(H,33,34,35)(H,36,37,38)/b26-24+,27-25+ |
| InChIKey | WXNMESZFUVLVPL-OWUYFMIJSA-N |
| XLogP | 5.03 |
| TPSA | 256.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|