C31H33N5O9S2 — CID 137294104
5-acetamido-3-[[4-[[4-(1,5-dihydroxypentan-3-ylsulfonyl)phenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 137294104) has the molecular formula C31H33N5O9S2 and a molecular weight of 683.77 g/mol. Its IUPAC name is 5-acetamido-3-[[4-[[4-(1,5-dihydroxypentan-3-ylsulfonyl)phenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 5-acetamido-3-[[4-[[4-(1,5-dihydroxypentan-3-ylsulfonyl)phenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137294104 |
| Molecular Formula | C31H33N5O9S2 |
| Molecular Weight | 683.77 g/mol |
| Exact Mass | 683.17 |
| IUPAC Name | 5-acetamido-3-[[4-[[4-(1,5-dihydroxypentan-3-ylsulfonyl)phenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CC(=O)Nc1cccc2cc(S(=O)(=O)O)c(/N=N/c3cc(C)c(/N=N/c4ccc(S(=O)(=O)C(CCO)CCO)cc4)cc3C)c(O)c12 |
| InChI | InChI=1S/C31H33N5O9S2/c1-18-16-27(35-36-30-28(47(43,44)45)17-21-5-4-6-25(32-20(3)39)29(21)31(30)40)19(2)15-26(18)34-33-22-7-9-23(10-8-22)46(41,42)24(11-13-37)12-14-38/h4-10,15-17,24,37-38,40H,11-14H2,1-3H3,(H,32,39)(H,43,44,45)/b34-33+,36-35+ |
| InChIKey | ZFLHGWMZQCUZGH-WXBFSDFVSA-N |
| XLogP | 6.11 |
| TPSA | 227.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.77 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|