C20H20N2OS2 — CID 3278465
N-(4-ethoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine (PubChem CID 3278465) has the molecular formula C20H20N2OS2 and a molecular weight of 368.53 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine.
| Compound Name | N-(4-ethoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine |
|---|---|
| PubChem CID | 3278465 |
| Molecular Formula | C20H20N2OS2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine |
| SMILES | CCOc1ccc(/N=c2\ssc3c2-c2ccccc2NC3(C)C)cc1 |
| InChI | InChI=1S/C20H20N2OS2/c1-4-23-14-11-9-13(10-12-14)21-19-17-15-7-5-6-8-16(15)22-20(2,3)18(17)24-25-19/h5-12,22H,4H2,1-3H3/b21-19- |
| InChIKey | CFZYTSQBYCPTOP-VZCXRCSSSA-N |
| XLogP | 5.77 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |