C26H24N2O2S2 — CID 3720486
8-methoxy-4,4-dimethyl-N-(4-phenylmethoxyphenyl)-5H-dithiolo[3,4-c]quinolin-1-imine (PubChem CID 3720486) has the molecular formula C26H24N2O2S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 8-methoxy-4,4-dimethyl-N-(4-phenylmethoxyphenyl)-5H-dithiolo[3,4-c]quinolin-1-imine.
| Compound Name | 8-methoxy-4,4-dimethyl-N-(4-phenylmethoxyphenyl)-5H-dithiolo[3,4-c]quinolin-1-imine |
|---|---|
| PubChem CID | 3720486 |
| Molecular Formula | C26H24N2O2S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 8-methoxy-4,4-dimethyl-N-(4-phenylmethoxyphenyl)-5H-dithiolo[3,4-c]quinolin-1-imine |
| SMILES | COc1ccc2c(c1)-c1c(ss/c1=N\c1ccc(OCc3ccccc3)cc1)C(C)(C)N2 |
| InChI | InChI=1S/C26H24N2O2S2/c1-26(2)24-23(21-15-20(29-3)13-14-22(21)28-26)25(32-31-24)27-18-9-11-19(12-10-18)30-16-17-7-5-4-6-8-17/h4-15,28H,16H2,1-3H3/b27-25- |
| InChIKey | YVAZXKGYPBKZPO-RFBIWTDZSA-N |
| XLogP | 6.96 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|