C15H18BrNOS3 — CID 44659157
8-ethoxy-4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium bromide (PubChem CID 44659157) has the molecular formula C15H18BrNOS3 and a molecular weight of 404.42 g/mol. Its IUPAC name is 8-ethoxy-4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium bromide.
| Compound Name | 8-ethoxy-4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium bromide |
|---|---|
| PubChem CID | 44659157 |
| Molecular Formula | C15H18BrNOS3 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 402.97 |
| IUPAC Name | 8-ethoxy-4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium bromide |
| SMILES | CCOc1ccc2c(c1)-c1c(s[s+]c1SC)C(C)(C)N2.[Br-] |
| InChI | InChI=1S/C15H18NOS3.BrH/c1-5-17-9-6-7-11-10(8-9)12-13(15(2,3)16-11)19-20-14(12)18-4;/h6-8,16H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QHKFEAUABRJOJT-UHFFFAOYSA-M |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|