About 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine
8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine (PubChem CID 2302192) has the molecular formula C21H22N2O2S2
and a molecular weight of 398.55 g/mol. Its IUPAC name is 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine.
Molecular Properties
| Compound Name | 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine |
| PubChem CID | 2302192 |
| Molecular Formula | C21H22N2O2S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine |
| SMILES | CCOc1ccc2c(c1)-c1c(ss/c1=N\c1ccc(OC)cc1)C(C)(C)N2 |
| InChI | InChI=1S/C21H22N2O2S2/c1-5-25-15-10-11-17-16(12-15)18-19(21(2,3)23-17)26-27-20(18)22-13-6-8-14(24-4)9-7-13/h6-12,23H,5H2,1-4H3/b22-20- |
| InChIKey | GAWUMMMRVDWBOV-XDOYNYLZSA-N |
| XLogP | 5.78 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine?
The IUPAC name of 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine (CID 2302192) is 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine.
What is the SMILES notation for 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine?
The canonical SMILES for 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine is CCOc1ccc2c(c1)-c1c(ss/c1=N\c1ccc(OC)cc1)C(C)(C)N2.
What is the InChIKey of 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine?
The InChIKey is GAWUMMMRVDWBOV-XDOYNYLZSA-N. The full InChI is InChI=1S/C21H22N2O2S2/c1-5-25-15-10-11-17-16(12-15)18-19(21(2,3)23-17)26-27-20(18)22-13-6-8-14(24-4)9-7-13/h6-12,23H,5H2,1-4H3/b22-20-.
What are the key properties of 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine?
8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine has a molecular weight of 398.55 g/mol, XLogP of 5.78, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethoxy-N-(4-methoxyphenyl)-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-imine is sourced from PubChem (CID 2302192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).