C25H35NO3 — CID 174821422
2-tert-butyl-4-methoxyphenol;6-ethoxy-2,2,4-trimethyl-1H-quinoline (PubChem CID 174821422) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is 2-tert-butyl-4-methoxyphenol;6-ethoxy-2,2,4-trimethyl-1H-quinoline.
| Compound Name | 2-tert-butyl-4-methoxyphenol;6-ethoxy-2,2,4-trimethyl-1H-quinoline |
|---|---|
| PubChem CID | 174821422 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 2-tert-butyl-4-methoxyphenol;6-ethoxy-2,2,4-trimethyl-1H-quinoline |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2.COc1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19NO.C11H16O2/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13;1-11(2,3)9-7-8(13-4)5-6-10(9)12/h6-9,15H,5H2,1-4H3;5-7,12H,1-4H3 |
| InChIKey | OTVJMZAUUVOPJT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|