C28H37NO5 — CID 122516802
6-ethoxy-2,2,4-trimethyl-1H-quinoline;6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 122516802) has the molecular formula C28H37NO5 and a molecular weight of 467.61 g/mol. Its IUPAC name is 6-ethoxy-2,2,4-trimethyl-1H-quinoline;6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline;6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 122516802 |
| Molecular Formula | C28H37NO5 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline;6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2.Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)O)O2 |
| InChI | InChI=1S/C14H19NO.C14H18O4/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13;1-7-8(2)12-10(9(3)11(7)15)5-6-14(4,18-12)13(16)17/h6-9,15H,5H2,1-4H3;15H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | IWBGQFSLJZJBFJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|