C53H64N4O4 — CID 70527981
2,2,4-trimethyl-6-[3-[(2,2,4-trimethyl-1H-quinolin-6-yl)oxy]-2,2-bis[(2,2,4-trimethyl-1H-quinolin-6-yl)oxymethyl]propoxy]-1H-quinoline (PubChem CID 70527981) has the molecular formula C53H64N4O4 and a molecular weight of 821.12 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-[3-[(2,2,4-trimethyl-1H-quinolin-6-yl)oxy]-2,2-bis[(2,2,4-trimethyl-1H-quinolin-6-yl)oxymethyl]propoxy]-1H-quinoline.
| Compound Name | 2,2,4-trimethyl-6-[3-[(2,2,4-trimethyl-1H-quinolin-6-yl)oxy]-2,2-bis[(2,2,4-trimethyl-1H-quinolin-6-yl)oxymethyl]propoxy]-1H-quinoline |
|---|---|
| PubChem CID | 70527981 |
| Molecular Formula | C53H64N4O4 |
| Molecular Weight | 821.12 g/mol |
| Exact Mass | 820.49 |
| IUPAC Name | 2,2,4-trimethyl-6-[3-[(2,2,4-trimethyl-1H-quinolin-6-yl)oxy]-2,2-bis[(2,2,4-trimethyl-1H-quinolin-6-yl)oxymethyl]propoxy]-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc(OCC(COc3ccc4c(c3)C(C)=CC(C)(C)N4)(COc3ccc4c(c3)C(C)=CC(C)(C)N4)COc3ccc4c(c3)C(C)=CC(C)(C)N4)cc21 |
| InChI | InChI=1S/C53H64N4O4/c1-33-25-49(5,6)54-45-17-13-37(21-41(33)45)58-29-53(30-59-38-14-18-46-42(22-38)34(2)26-50(7,8)55-46,31-60-39-15-19-47-43(23-39)35(3)27-51(9,10)56-47)32-61-40-16-20-48-44(24-40)36(4)28-52(11,12)57-48/h13-28,54-57H,29-32H2,1-12H3 |
| InChIKey | AWPBCSRDQNRMBS-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.12 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|