C19H26N2O2 — CID 737972
(2,2,4-trimethyl-1H-quinolin-6-yl) N-cyclohexylcarbamate (PubChem CID 737972) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2,2,4-trimethyl-1H-quinolin-6-yl) N-cyclohexylcarbamate.
| Compound Name | (2,2,4-trimethyl-1H-quinolin-6-yl) N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 737972 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (2,2,4-trimethyl-1H-quinolin-6-yl) N-cyclohexylcarbamate |
| SMILES | CC1=CC(C)(C)Nc2ccc(OC(=O)NC3CCCCC3)cc21 |
| InChI | InChI=1S/C19H26N2O2/c1-13-12-19(2,3)21-17-10-9-15(11-16(13)17)23-18(22)20-14-7-5-4-6-8-14/h9-12,14,21H,4-8H2,1-3H3,(H,20,22) |
| InChIKey | DXICXPWESAKUNL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |