About (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate
(2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate (PubChem CID 698304) has the molecular formula C20H21NO3
and a molecular weight of 323.39 g/mol. Its IUPAC name is (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate.
Molecular Properties
| Compound Name | (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate |
| PubChem CID | 698304 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate |
| SMILES | CC1=CC(C)(C)Nc2ccc(OC(=O)COc3ccccc3)cc21 |
| InChI | InChI=1S/C20H21NO3/c1-14-12-20(2,3)21-18-10-9-16(11-17(14)18)24-19(22)13-23-15-7-5-4-6-8-15/h4-12,21H,13H2,1-3H3 |
| InChIKey | CLUHLYUWVGPJPV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate?
The IUPAC name of (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate (CID 698304) is (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate.
What is the SMILES notation for (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate?
The canonical SMILES for (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate is CC1=CC(C)(C)Nc2ccc(OC(=O)COc3ccccc3)cc21.
What is the InChIKey of (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate?
The InChIKey is CLUHLYUWVGPJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO3/c1-14-12-20(2,3)21-18-10-9-16(11-17(14)18)24-19(22)13-23-15-7-5-4-6-8-15/h4-12,21H,13H2,1-3H3.
What are the key properties of (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate?
(2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate has a molecular weight of 323.39 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenoxyacetate is sourced from PubChem (CID 698304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).