C17H21NO3 — CID 6541641
(2,2,4-trimethyl-1H-quinolin-6-yl) (2S)-oxolane-2-carboxylate (PubChem CID 6541641) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2,2,4-trimethyl-1H-quinolin-6-yl) (2S)-oxolane-2-carboxylate.
| Compound Name | (2,2,4-trimethyl-1H-quinolin-6-yl) (2S)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 6541641 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2,2,4-trimethyl-1H-quinolin-6-yl) (2S)-oxolane-2-carboxylate |
| SMILES | CC1=CC(C)(C)Nc2ccc(OC(=O)[C@@H]3CCCO3)cc21 |
| InChI | InChI=1S/C17H21NO3/c1-11-10-17(2,3)18-14-7-6-12(9-13(11)14)21-16(19)15-5-4-8-20-15/h6-7,9-10,15,18H,4-5,8H2,1-3H3/t15-/m0/s1 |
| InChIKey | SQRBRJKPNNKVOT-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|