C18H19NO2S — CID 2294173
(2,2,4-trimethyl-1H-quinolin-6-yl) 2-thiophen-2-ylacetate (PubChem CID 2294173) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is (2,2,4-trimethyl-1H-quinolin-6-yl) 2-thiophen-2-ylacetate.
| Compound Name | (2,2,4-trimethyl-1H-quinolin-6-yl) 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 2294173 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (2,2,4-trimethyl-1H-quinolin-6-yl) 2-thiophen-2-ylacetate |
| SMILES | CC1=CC(C)(C)Nc2ccc(OC(=O)Cc3cccs3)cc21 |
| InChI | InChI=1S/C18H19NO2S/c1-12-11-18(2,3)19-16-7-6-13(9-15(12)16)21-17(20)10-14-5-4-8-22-14/h4-9,11,19H,10H2,1-3H3 |
| InChIKey | MRAQLXQOPNYVRL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|