C14H20ClNO — CID 167531367
2,2,4-trimethyl-6-(1,1,2,2,2-pentadeuterioethoxy)-1H-quinoline;hydrochloride (PubChem CID 167531367) has the molecular formula C14H20ClNO and a molecular weight of 258.80 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-(1,1,2,2,2-pentadeuterioethoxy)-1H-quinoline;hydrochloride.
| Compound Name | 2,2,4-trimethyl-6-(1,1,2,2,2-pentadeuterioethoxy)-1H-quinoline;hydrochloride |
|---|---|
| PubChem CID | 167531367 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 258.80 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2,2,4-trimethyl-6-(1,1,2,2,2-pentadeuterioethoxy)-1H-quinoline;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])C([2H])([2H])Oc1ccc2c(c1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C14H19NO.ClH/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13;/h6-9,15H,5H2,1-4H3;1H/i1D3,5D2; |
| InChIKey | XWPXIVUWKRKUJM-PAJIIYFZSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.80 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|