C14H19FeNO2 — CID 67924358
6-ethoxy-2,2,4-trimethyl-1H-quinoline;oxoiron (PubChem CID 67924358) has the molecular formula C14H19FeNO2 and a molecular weight of 289.16 g/mol. Its IUPAC name is 6-ethoxy-2,2,4-trimethyl-1H-quinoline;oxoiron.
| Compound Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline;oxoiron |
|---|---|
| PubChem CID | 67924358 |
| Molecular Formula | C14H19FeNO2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline;oxoiron |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2.O=[Fe] |
| InChI | InChI=1S/C14H19NO.Fe.O/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13;;/h6-9,15H,5H2,1-4H3;; |
| InChIKey | DPZUUPHOQIOWLS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|