C24H29NO4 — CID 174899316
6-ethoxy-2,2,4-trimethyl-1H-quinoline;phenoxymethyl prop-2-enoate (PubChem CID 174899316) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 6-ethoxy-2,2,4-trimethyl-1H-quinoline;phenoxymethyl prop-2-enoate.
| Compound Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline;phenoxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 174899316 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline;phenoxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccccc1.CCOc1ccc2c(c1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C14H19NO.C10H10O3/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13;1-2-10(11)13-8-12-9-6-4-3-5-7-9/h6-9,15H,5H2,1-4H3;2-7H,1,8H2 |
| InChIKey | DUPNYFYXRSPYNS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|