C18H18N2O3 — CID 166995939
[4-[(3,4-dimethylphenyl)diazenyl]phenoxy]methyl prop-2-enoate (PubChem CID 166995939) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)diazenyl]phenoxy]methyl prop-2-enoate.
| Compound Name | [4-[(3,4-dimethylphenyl)diazenyl]phenoxy]methyl prop-2-enoate |
|---|---|
| PubChem CID | 166995939 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)diazenyl]phenoxy]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc(/N=N/c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H18N2O3/c1-4-18(21)23-12-22-17-9-7-15(8-10-17)19-20-16-6-5-13(2)14(3)11-16/h4-11H,1,12H2,2-3H3/b20-19+ |
| InChIKey | JBISQCFCJKNONX-FMQUCBEESA-N |
| XLogP | 4.78 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|