C16H13O5S- — CID 21361886
4-[4-(prop-2-enoyloxymethoxy)phenyl]benzenesulfinate (PubChem CID 21361886) has the molecular formula C16H13O5S- and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-[4-(prop-2-enoyloxymethoxy)phenyl]benzenesulfinate.
| Compound Name | 4-[4-(prop-2-enoyloxymethoxy)phenyl]benzenesulfinate |
|---|---|
| PubChem CID | 21361886 |
| Molecular Formula | C16H13O5S- |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-[4-(prop-2-enoyloxymethoxy)phenyl]benzenesulfinate |
| SMILES | C=CC(=O)OCOc1ccc(-c2ccc(S(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H14O5S/c1-2-16(17)21-11-20-14-7-3-12(4-8-14)13-5-9-15(10-6-13)22(18)19/h2-10H,1,11H2,(H,18,19)/p-1 |
| InChIKey | QTOICVBUWMCACT-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|