C40H42N6O8 — CID 156628743
4-[4-[[3-(hydroxymethyl)-4-[[3-(hydroxymethyl)-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]butyl prop-2-enoate (PubChem CID 156628743) has the molecular formula C40H42N6O8 and a molecular weight of 734.81 g/mol. Its IUPAC name is 4-[4-[[3-(hydroxymethyl)-4-[[3-(hydroxymethyl)-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]butyl prop-2-enoate.
| Compound Name | 4-[4-[[3-(hydroxymethyl)-4-[[3-(hydroxymethyl)-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 156628743 |
| Molecular Formula | C40H42N6O8 |
| Molecular Weight | 734.81 g/mol |
| Exact Mass | 734.31 |
| IUPAC Name | 4-[4-[[3-(hydroxymethyl)-4-[[3-(hydroxymethyl)-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc(OCCCCOC(=O)C=C)cc4)c(CO)c3)c(CO)c2)cc1 |
| InChI | InChI=1S/C40H42N6O8/c1-3-39(49)53-23-7-5-21-51-35-15-9-31(10-16-35)41-43-33-13-19-38(29(25-33)27-47)46-44-34-14-20-37(30(26-34)28-48)45-42-32-11-17-36(18-12-32)52-22-6-8-24-54-40(50)4-2/h3-4,9-20,25-26,47-48H,1-2,5-8,21-24,27-28H2/b43-41+,45-42+,46-44+ |
| InChIKey | CRZUQXNFGZVIIG-WTPYYKASSA-N |
| XLogP | 9.69 |
| TPSA | 185.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.81 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|