C41H50N2O5 — CID 140930643
6-[4-[[4-[2-[4-(10-oxododec-11-enoxy)phenyl]ethenyl]phenyl]diazenyl]phenoxy]hexyl prop-2-enoate (PubChem CID 140930643) has the molecular formula C41H50N2O5 and a molecular weight of 650.86 g/mol. Its IUPAC name is 6-[4-[[4-[2-[4-(10-oxododec-11-enoxy)phenyl]ethenyl]phenyl]diazenyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[[4-[2-[4-(10-oxododec-11-enoxy)phenyl]ethenyl]phenyl]diazenyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 140930643 |
| Molecular Formula | C41H50N2O5 |
| Molecular Weight | 650.86 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | 6-[4-[[4-[2-[4-(10-oxododec-11-enoxy)phenyl]ethenyl]phenyl]diazenyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)CCCCCCCCCOc1ccc(C=Cc2ccc(/N=N/c3ccc(OCCCCCCOC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H50N2O5/c1-3-38(44)16-12-8-6-5-7-9-13-31-46-39-27-21-35(22-28-39)18-17-34-19-23-36(24-20-34)42-43-37-25-29-40(30-26-37)47-32-14-10-11-15-33-48-41(45)4-2/h3-4,17-30H,1-2,5-16,31-33H2/b18-17?,43-42+ |
| InChIKey | XXVRQOITHUIPDQ-PAWJQDNASA-N |
| XLogP | 11.20 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.86 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|