C33H29NO6 — CID 156673241
[3-[4-(4-methylphenyl)-N-[3-(prop-2-enoyloxymethoxy)phenyl]anilino]phenoxy]methyl prop-2-enoate (PubChem CID 156673241) has the molecular formula C33H29NO6 and a molecular weight of 535.60 g/mol. Its IUPAC name is [3-[4-(4-methylphenyl)-N-[3-(prop-2-enoyloxymethoxy)phenyl]anilino]phenoxy]methyl prop-2-enoate.
| Compound Name | [3-[4-(4-methylphenyl)-N-[3-(prop-2-enoyloxymethoxy)phenyl]anilino]phenoxy]methyl prop-2-enoate |
|---|---|
| PubChem CID | 156673241 |
| Molecular Formula | C33H29NO6 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | [3-[4-(4-methylphenyl)-N-[3-(prop-2-enoyloxymethoxy)phenyl]anilino]phenoxy]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1cccc(N(c2ccc(-c3ccc(C)cc3)cc2)c2cccc(OCOC(=O)C=C)c2)c1 |
| InChI | InChI=1S/C33H29NO6/c1-4-32(35)39-22-37-30-10-6-8-28(20-30)34(29-9-7-11-31(21-29)38-23-40-33(36)5-2)27-18-16-26(17-19-27)25-14-12-24(3)13-15-25/h4-21H,1-2,22-23H2,3H3 |
| InChIKey | CNRGSAGAWKPHFK-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|