C46H44N2O3 — CID 134253403
[4-[N-(2,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)-2,4-dimethylanilino)phenyl]anilino]phenoxy]methyl prop-2-enoate (PubChem CID 134253403) has the molecular formula C46H44N2O3 and a molecular weight of 672.87 g/mol. Its IUPAC name is [4-[N-(2,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)-2,4-dimethylanilino)phenyl]anilino]phenoxy]methyl prop-2-enoate.
| Compound Name | [4-[N-(2,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)-2,4-dimethylanilino)phenyl]anilino]phenoxy]methyl prop-2-enoate |
|---|---|
| PubChem CID | 134253403 |
| Molecular Formula | C46H44N2O3 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | [4-[N-(2,4-dimethylphenyl)-4-[4-(N-(2,4-dimethylphenyl)-2,4-dimethylanilino)phenyl]anilino]phenoxy]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc(N(c2ccc(-c3ccc(N(c4ccc(C)cc4C)c4ccc(C)cc4C)cc3)cc2)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C46H44N2O3/c1-8-46(49)51-30-50-42-22-20-40(21-23-42)47(43-24-9-31(2)27-34(43)5)39-16-12-37(13-17-39)38-14-18-41(19-15-38)48(44-25-10-32(3)28-35(44)6)45-26-11-33(4)29-36(45)7/h8-29H,1,30H2,2-7H3 |
| InChIKey | ISGQXMCUPAVNHY-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|