C59H46N2O8 — CID 22089897
[4-[N-(4-ethenoxyphenyl)-4-[4-[[4-[4-(4-ethenoxy-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]phenoxy]methoxy]phenyl]anilino]phenyl] prop-2-enoate (PubChem CID 22089897) has the molecular formula C59H46N2O8 and a molecular weight of 911.02 g/mol. Its IUPAC name is [4-[N-(4-ethenoxyphenyl)-4-[4-[[4-[4-(4-ethenoxy-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]phenoxy]methoxy]phenyl]anilino]phenyl] prop-2-enoate.
| Compound Name | [4-[N-(4-ethenoxyphenyl)-4-[4-[[4-[4-(4-ethenoxy-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]phenoxy]methoxy]phenyl]anilino]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 22089897 |
| Molecular Formula | C59H46N2O8 |
| Molecular Weight | 911.02 g/mol |
| Exact Mass | 910.33 |
| IUPAC Name | [4-[N-(4-ethenoxyphenyl)-4-[4-[[4-[4-(4-ethenoxy-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]phenoxy]methoxy]phenyl]anilino]phenyl] prop-2-enoate |
| SMILES | C=COc1ccc(N(c2ccc(OC(=O)C=C)cc2)c2ccc(-c3ccc(OCOc4ccc(-c5ccc(N(c6ccc(OC=C)cc6)c6ccc(OC(=O)C=C)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C59H46N2O8/c1-5-58(62)68-56-37-25-50(26-38-56)60(48-21-33-52(34-22-48)64-7-3)46-17-9-42(10-18-46)44-13-29-54(30-14-44)66-41-67-55-31-15-45(16-32-55)43-11-19-47(20-12-43)61(49-23-35-53(36-24-49)65-8-4)51-27-39-57(40-28-51)69-59(63)6-2/h5-40H,1-4,41H2 |
| InChIKey | WIGFUDSCSBZMDS-UHFFFAOYSA-N |
| XLogP | 14.60 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.02 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|