C32H28N2O4 — CID 22089770
[3-[N-methyl-4-[4-(N-methyl-3-prop-2-enoyloxyanilino)phenyl]anilino]phenyl] prop-2-enoate (PubChem CID 22089770) has the molecular formula C32H28N2O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is [3-[N-methyl-4-[4-(N-methyl-3-prop-2-enoyloxyanilino)phenyl]anilino]phenyl] prop-2-enoate.
| Compound Name | [3-[N-methyl-4-[4-(N-methyl-3-prop-2-enoyloxyanilino)phenyl]anilino]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 22089770 |
| Molecular Formula | C32H28N2O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | [3-[N-methyl-4-[4-(N-methyl-3-prop-2-enoyloxyanilino)phenyl]anilino]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cccc(N(C)c2ccc(-c3ccc(N(C)c4cccc(OC(=O)C=C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C32H28N2O4/c1-5-31(35)37-29-11-7-9-27(21-29)33(3)25-17-13-23(14-18-25)24-15-19-26(20-16-24)34(4)28-10-8-12-30(22-28)38-32(36)6-2/h5-22H,1-2H2,3-4H3 |
| InChIKey | IOZUUQFKOWQFBH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|