C24H21NO4 — CID 90291391
[3-(N-(3,4-dimethylphenyl)-3-formyloxyanilino)phenyl] prop-2-enoate (PubChem CID 90291391) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is [3-(N-(3,4-dimethylphenyl)-3-formyloxyanilino)phenyl] prop-2-enoate.
| Compound Name | [3-(N-(3,4-dimethylphenyl)-3-formyloxyanilino)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 90291391 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [3-(N-(3,4-dimethylphenyl)-3-formyloxyanilino)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cccc(N(c2cccc(OC=O)c2)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C24H21NO4/c1-4-24(27)29-23-10-6-8-20(15-23)25(21-12-11-17(2)18(3)13-21)19-7-5-9-22(14-19)28-16-26/h4-16H,1H2,2-3H3 |
| InChIKey | LJXFLKKKGHJSFJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|