C29H35Cl3N4O3 — CID 70279829
6-ethoxy-2,2,4-trimethyl-1H-quinoline;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide (PubChem CID 70279829) has the molecular formula C29H35Cl3N4O3 and a molecular weight of 593.98 g/mol. Its IUPAC name is 6-ethoxy-2,2,4-trimethyl-1H-quinoline;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide.
| Compound Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 70279829 |
| Molecular Formula | C29H35Cl3N4O3 |
| Molecular Weight | 593.98 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide |
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)n1ccnc1.CCOc1ccc2c(c1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C15H16Cl3N3O2.C14H19NO/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18;1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h3,5,8-10H,2,4,6-7H2,1H3;6-9,15H,5H2,1-4H3 |
| InChIKey | UNRVGVIDNINZFY-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.98 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|