C19H18ClNO2 — CID 698306
(2,2,4-trimethyl-1H-quinolin-6-yl) 4-chlorobenzoate (PubChem CID 698306) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is (2,2,4-trimethyl-1H-quinolin-6-yl) 4-chlorobenzoate.
| Compound Name | (2,2,4-trimethyl-1H-quinolin-6-yl) 4-chlorobenzoate |
|---|---|
| PubChem CID | 698306 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (2,2,4-trimethyl-1H-quinolin-6-yl) 4-chlorobenzoate |
| SMILES | CC1=CC(C)(C)Nc2ccc(OC(=O)c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C19H18ClNO2/c1-12-11-19(2,3)21-17-9-8-15(10-16(12)17)23-18(22)13-4-6-14(20)7-5-13/h4-11,21H,1-3H3 |
| InChIKey | RUPUCWYRDHVEEG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|