C34H33FN2O4 — CID 44513173
[3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 4-fluorobenzoate (PubChem CID 44513173) has the molecular formula C34H33FN2O4 and a molecular weight of 552.65 g/mol. Its IUPAC name is [3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 4-fluorobenzoate.
| Compound Name | [3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 44513173 |
| Molecular Formula | C34H33FN2O4 |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | [3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 4-fluorobenzoate |
| SMILES | COc1ccccc1NCc1c(-c2ccc(OC(=O)c3ccc(F)cc3)cc2OC)ccc2c1C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C34H33FN2O4/c1-21-19-34(2,3)37-29-17-16-25(27(32(21)29)20-36-28-8-6-7-9-30(28)39-4)26-15-14-24(18-31(26)40-5)41-33(38)22-10-12-23(35)13-11-22/h6-19,36-37H,20H2,1-5H3 |
| InChIKey | WZTMYQCFENJEBZ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|