C30H36N2O5S — CID 44514158
[3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] propane-1-sulfonate (PubChem CID 44514158) has the molecular formula C30H36N2O5S and a molecular weight of 536.69 g/mol. Its IUPAC name is [3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] propane-1-sulfonate.
| Compound Name | [3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] propane-1-sulfonate |
|---|---|
| PubChem CID | 44514158 |
| Molecular Formula | C30H36N2O5S |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | [3-methoxy-4-[5-[(2-methoxyanilino)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1ccc(-c2ccc3c(c2CNc2ccccc2OC)C(C)=CC(C)(C)N3)c(OC)c1 |
| InChI | InChI=1S/C30H36N2O5S/c1-7-16-38(33,34)37-21-12-13-23(28(17-21)36-6)22-14-15-26-29(20(2)18-30(3,4)32-26)24(22)19-31-25-10-8-9-11-27(25)35-5/h8-15,17-18,31-32H,7,16,19H2,1-6H3 |
| InChIKey | MIYGXFIBFAABCB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|