C28H27F4NO5S — CID 87667592
[4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 87667592) has the molecular formula C28H27F4NO5S and a molecular weight of 565.59 g/mol. Its IUPAC name is [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87667592 |
| Molecular Formula | C28H27F4NO5S |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)ccc1-c1ccc2c(c1COc1cc(F)ccc1C)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C28H27F4NO5S/c1-16-6-7-18(29)12-24(16)37-15-22-20(10-11-23-26(22)17(2)14-27(3,4)33-23)21-9-8-19(13-25(21)36-5)38-39(34,35)28(30,31)32/h6-14,33H,15H2,1-5H3 |
| InChIKey | OLMPOHMLRBRSKF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|