C34H34FNO4 — CID 89490620
5-[(5-fluoro-2-methylphenoxy)methyl]-6-[2-methoxy-4-(2-methylphenyl)peroxyphenyl]-2,2,4-trimethyl-1H-quinoline (PubChem CID 89490620) has the molecular formula C34H34FNO4 and a molecular weight of 539.65 g/mol. Its IUPAC name is 5-[(5-fluoro-2-methylphenoxy)methyl]-6-[2-methoxy-4-(2-methylphenyl)peroxyphenyl]-2,2,4-trimethyl-1H-quinoline.
| Compound Name | 5-[(5-fluoro-2-methylphenoxy)methyl]-6-[2-methoxy-4-(2-methylphenyl)peroxyphenyl]-2,2,4-trimethyl-1H-quinoline |
|---|---|
| PubChem CID | 89490620 |
| Molecular Formula | C34H34FNO4 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 5-[(5-fluoro-2-methylphenoxy)methyl]-6-[2-methoxy-4-(2-methylphenyl)peroxyphenyl]-2,2,4-trimethyl-1H-quinoline |
| SMILES | COc1cc(OOc2ccccc2C)ccc1-c1ccc2c(c1COc1cc(F)ccc1C)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C34H34FNO4/c1-21-9-7-8-10-30(21)40-39-25-13-14-27(32(18-25)37-6)26-15-16-29-33(23(3)19-34(4,5)36-29)28(26)20-38-31-17-24(35)12-11-22(31)2/h7-19,36H,20H2,1-6H3 |
| InChIKey | IRXUWUZPELMSHU-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|