C34H36FNO3S — CID 143673324
4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenol;phenylmethanethiol (PubChem CID 143673324) has the molecular formula C34H36FNO3S and a molecular weight of 557.73 g/mol. Its IUPAC name is 4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenol;phenylmethanethiol.
| Compound Name | 4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenol;phenylmethanethiol |
|---|---|
| PubChem CID | 143673324 |
| Molecular Formula | C34H36FNO3S |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenol;phenylmethanethiol |
| SMILES | COc1cc(O)ccc1-c1ccc2c(c1COc1cc(F)ccc1C)C(C)=CC(C)(C)N2.SCc1ccccc1 |
| InChI | InChI=1S/C27H28FNO3.C7H8S/c1-16-6-7-18(28)12-24(16)32-15-22-20(21-9-8-19(30)13-25(21)31-5)10-11-23-26(22)17(2)14-27(3,4)29-23;8-6-7-4-2-1-3-5-7/h6-14,29-30H,15H2,1-5H3;1-5,8H,6H2 |
| InChIKey | NFYWEMFZRPTHEF-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|