C35H34FNO5 — CID 59224343
benzyl [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] carbonate (PubChem CID 59224343) has the molecular formula C35H34FNO5 and a molecular weight of 567.66 g/mol. Its IUPAC name is benzyl [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] carbonate.
| Compound Name | benzyl [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] carbonate |
|---|---|
| PubChem CID | 59224343 |
| Molecular Formula | C35H34FNO5 |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | benzyl [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] carbonate |
| SMILES | COc1cc(OC(=O)OCc2ccccc2)ccc1-c1ccc2c(c1COc1cc(F)ccc1C)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C35H34FNO5/c1-22-11-12-25(36)17-31(22)40-21-29-27(15-16-30-33(29)23(2)19-35(3,4)37-30)28-14-13-26(18-32(28)39-5)42-34(38)41-20-24-9-7-6-8-10-24/h6-19,37H,20-21H2,1-5H3 |
| InChIKey | DOJOOWUJZPXVSQ-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|