C34H33ClFNO4 — CID 67176898
6-[4-[(2-chlorophenoxy)methoxy]-2-methoxyphenyl]-5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinoline (PubChem CID 67176898) has the molecular formula C34H33ClFNO4 and a molecular weight of 574.09 g/mol. Its IUPAC name is 6-[4-[(2-chlorophenoxy)methoxy]-2-methoxyphenyl]-5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinoline.
| Compound Name | 6-[4-[(2-chlorophenoxy)methoxy]-2-methoxyphenyl]-5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinoline |
|---|---|
| PubChem CID | 67176898 |
| Molecular Formula | C34H33ClFNO4 |
| Molecular Weight | 574.09 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 6-[4-[(2-chlorophenoxy)methoxy]-2-methoxyphenyl]-5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinoline |
| SMILES | COc1cc(OCOc2ccccc2Cl)ccc1-c1ccc2c(c1COc1cc(F)ccc1C)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C34H33ClFNO4/c1-21-10-11-23(36)16-31(21)39-19-27-25(14-15-29-33(27)22(2)18-34(3,4)37-29)26-13-12-24(17-32(26)38-5)40-20-41-30-9-7-6-8-28(30)35/h6-18,37H,19-20H2,1-5H3 |
| InChIKey | WTVKMOQGLRQMTK-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.09 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|