About [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate
[4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate (PubChem CID 89490680) has the molecular formula C22H25NO4
and a molecular weight of 367.45 g/mol. Its IUPAC name is [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate.
Molecular Properties
| Compound Name | [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate |
| PubChem CID | 89490680 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate |
| SMILES | COc1cc(OC(C)=O)ccc1-c1ccc2c(c1CO)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C22H25NO4/c1-13-11-22(3,4)23-19-9-8-16(18(12-24)21(13)19)17-7-6-15(27-14(2)25)10-20(17)26-5/h6-11,23-24H,12H2,1-5H3 |
| InChIKey | JLBOVXVJXKUGBH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate?
The IUPAC name of [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate (CID 89490680) is [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate.
What is the SMILES notation for [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate?
The canonical SMILES for [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate is COc1cc(OC(C)=O)ccc1-c1ccc2c(c1CO)C(C)=CC(C)(C)N2.
What is the InChIKey of [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate?
The InChIKey is JLBOVXVJXKUGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO4/c1-13-11-22(3,4)23-19-9-8-16(18(12-24)21(13)19)17-7-6-15(27-14(2)25)10-20(17)26-5/h6-11,23-24H,12H2,1-5H3.
What are the key properties of [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate?
[4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate has a molecular weight of 367.45 g/mol, XLogP of 4.39, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate is sourced from PubChem (CID 89490680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).