C22H25NO4 — CID 89490680
[4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate (PubChem CID 89490680) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate.
| Compound Name | [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 89490680 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [4-[5-(hydroxymethyl)-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] acetate |
| SMILES | COc1cc(OC(C)=O)ccc1-c1ccc2c(c1CO)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C22H25NO4/c1-13-11-22(3,4)23-19-9-8-16(18(12-24)21(13)19)17-7-6-15(27-14(2)25)10-20(17)26-5/h6-11,23-24H,12H2,1-5H3 |
| InChIKey | JLBOVXVJXKUGBH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|