C35H32ClNO6 — CID 24891627
[3-methoxy-4-[5-[(4-methoxybenzoyl)oxymethyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 2-chlorobenzoate (PubChem CID 24891627) has the molecular formula C35H32ClNO6 and a molecular weight of 598.10 g/mol. Its IUPAC name is [3-methoxy-4-[5-[(4-methoxybenzoyl)oxymethyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 2-chlorobenzoate.
| Compound Name | [3-methoxy-4-[5-[(4-methoxybenzoyl)oxymethyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 24891627 |
| Molecular Formula | C35H32ClNO6 |
| Molecular Weight | 598.10 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | [3-methoxy-4-[5-[(4-methoxybenzoyl)oxymethyl]-2,2,4-trimethyl-1H-quinolin-6-yl]phenyl] 2-chlorobenzoate |
| SMILES | COc1ccc(C(=O)OCc2c(-c3ccc(OC(=O)c4ccccc4Cl)cc3OC)ccc3c2C(C)=CC(C)(C)N3)cc1 |
| InChI | InChI=1S/C35H32ClNO6/c1-21-19-35(2,3)37-30-17-16-25(28(32(21)30)20-42-33(38)22-10-12-23(40-4)13-11-22)26-15-14-24(18-31(26)41-5)43-34(39)27-8-6-7-9-29(27)36/h6-19,37H,20H2,1-5H3 |
| InChIKey | LKRCFRBOYWANKD-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.10 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|