About [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate
[6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate (PubChem CID 16659992) has the molecular formula C25H25NO3S
and a molecular weight of 419.55 g/mol. Its IUPAC name is [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate |
| PubChem CID | 16659992 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate |
| SMILES | COc1ccccc1-c1ccc2c(c1COC(=O)c1cccs1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C25H25NO3S/c1-16-14-25(2,3)26-20-12-11-17(18-8-5-6-9-21(18)28-4)19(23(16)20)15-29-24(27)22-10-7-13-30-22/h5-14,26H,15H2,1-4H3 |
| InChIKey | IEBYPVJVAFFVJZ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate?
The IUPAC name of [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate (CID 16659992) is [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate.
What is the SMILES notation for [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate?
The canonical SMILES for [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate is COc1ccccc1-c1ccc2c(c1COC(=O)c1cccs1)C(C)=CC(C)(C)N2.
What is the InChIKey of [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate?
The InChIKey is IEBYPVJVAFFVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO3S/c1-16-14-25(2,3)26-20-12-11-17(18-8-5-6-9-21(18)28-4)19(23(16)20)15-29-24(27)22-10-7-13-30-22/h5-14,26H,15H2,1-4H3.
What are the key properties of [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate?
[6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate has a molecular weight of 419.55 g/mol, XLogP of 6.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl thiophene-2-carboxylate is sourced from PubChem (CID 16659992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).