C29H28FNO3 — CID 67390985
[6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 3-phenylprop-2-enoate (PubChem CID 67390985) has the molecular formula C29H28FNO3 and a molecular weight of 457.55 g/mol. Its IUPAC name is [6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 3-phenylprop-2-enoate.
| Compound Name | [6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 67390985 |
| Molecular Formula | C29H28FNO3 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 3-phenylprop-2-enoate |
| SMILES | COc1cc(F)ccc1-c1ccc2c(c1COC(=O)C=Cc1ccccc1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C29H28FNO3/c1-19-17-29(2,3)31-25-14-13-22(23-12-11-21(30)16-26(23)33-4)24(28(19)25)18-34-27(32)15-10-20-8-6-5-7-9-20/h5-17,31H,18H2,1-4H3 |
| InChIKey | IXLDOIQSJPXVNM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|