About [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate
[6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate (PubChem CID 58026725) has the molecular formula C28H28FNO4
and a molecular weight of 461.53 g/mol. Its IUPAC name is [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate.
Molecular Properties
| Compound Name | [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate |
| PubChem CID | 58026725 |
| Molecular Formula | C28H28FNO4 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2c(-c3cc(F)ccc3OC)ccc3c2C(C)=CC(C)(C)N3)cc1 |
| InChI | InChI=1S/C28H28FNO4/c1-17-15-28(2,3)30-24-12-11-21(22-14-19(29)8-13-25(22)33-5)23(26(17)24)16-34-27(31)18-6-9-20(32-4)10-7-18/h6-15,30H,16H2,1-5H3 |
| InChIKey | QSFKJSITRMOGRC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate?
The IUPAC name of [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate (CID 58026725) is [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate.
What is the SMILES notation for [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate?
The canonical SMILES for [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate is COc1ccc(C(=O)OCc2c(-c3cc(F)ccc3OC)ccc3c2C(C)=CC(C)(C)N3)cc1.
What is the InChIKey of [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate?
The InChIKey is QSFKJSITRMOGRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28FNO4/c1-17-15-28(2,3)30-24-12-11-21(22-14-19(29)8-13-25(22)33-5)23(26(17)24)16-34-27(31)18-6-9-20(32-4)10-7-18/h6-15,30H,16H2,1-5H3.
What are the key properties of [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate?
[6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate has a molecular weight of 461.53 g/mol, XLogP of 6.47, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(5-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]methyl 4-methoxybenzoate is sourced from PubChem (CID 58026725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).