C34H31ClFNO4 — CID 25008317
[3-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-4-methoxyphenyl] 4-chlorobenzoate (PubChem CID 25008317) has the molecular formula C34H31ClFNO4 and a molecular weight of 572.08 g/mol. Its IUPAC name is [3-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-4-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [3-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-4-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 25008317 |
| Molecular Formula | C34H31ClFNO4 |
| Molecular Weight | 572.08 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | [3-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-4-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1ccc(OC(=O)c2ccc(Cl)cc2)cc1-c1ccc2c(c1COc1cc(F)ccc1C)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C34H31ClFNO4/c1-20-6-11-24(36)16-31(20)40-19-28-26(13-14-29-32(28)21(2)18-34(3,4)37-29)27-17-25(12-15-30(27)39-5)41-33(38)22-7-9-23(35)10-8-22/h6-18,37H,19H2,1-5H3 |
| InChIKey | UKVVQHLNEOJDBC-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.08 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|